C46H28O — CID 176840818
15,16,17,18,21-pentadeuterio-20-[10-(2-phenylphenyl)anthracen-9-yl]-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaene (PubChem CID 176840818) has the molecular formula C46H28O and a molecular weight of 601.76 g/mol. Its IUPAC name is 15,16,17,18,21-pentadeuterio-20-[10-(2-phenylphenyl)anthracen-9-yl]-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaene.
| Compound Name | 15,16,17,18,21-pentadeuterio-20-[10-(2-phenylphenyl)anthracen-9-yl]-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176840818 |
| Molecular Formula | C46H28O |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 15,16,17,18,21-pentadeuterio-20-[10-(2-phenylphenyl)anthracen-9-yl]-12-oxapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c(-c1c3ccccc3c(-c3ccccc3-c3ccccc3)c3ccccc13)c([2H])c1c3cc4ccccc4cc3oc21 |
| InChI | InChI=1S/C46H28O/c1-2-14-29(15-3-1)32-18-6-8-20-34(32)44-35-21-9-11-23-37(35)45(38-24-12-10-22-36(38)44)41-28-42-40-26-30-16-4-5-17-31(30)27-43(40)47-46(42)39-25-13-7-19-33(39)41/h1-28H/i7D,13D,19D,25D,28D |
| InChIKey | RPLOXXNCARKJMX-YIWLLUHISA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|