C43H26O — CID 176840870
4,6,7,8,9,11-hexadeuterio-15-(10-phenylanthracen-9-yl)-13-oxahexacyclo[14.7.1.02,14.03,12.05,10.020,24]tetracosa-1,3,5,7,9,11,14,16,18,20(24),22-undecaene (PubChem CID 176840870) has the molecular formula C43H26O and a molecular weight of 564.72 g/mol. Its IUPAC name is 4,6,7,8,9,11-hexadeuterio-15-(10-phenylanthracen-9-yl)-13-oxahexacyclo[14.7.1.02,14.03,12.05,10.020,24]tetracosa-1,3,5,7,9,11,14,16,18,20(24),22-undecaene.
| Compound Name | 4,6,7,8,9,11-hexadeuterio-15-(10-phenylanthracen-9-yl)-13-oxahexacyclo[14.7.1.02,14.03,12.05,10.020,24]tetracosa-1,3,5,7,9,11,14,16,18,20(24),22-undecaene |
|---|---|
| PubChem CID | 176840870 |
| Molecular Formula | C43H26O |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 4,6,7,8,9,11-hexadeuterio-15-(10-phenylanthracen-9-yl)-13-oxahexacyclo[14.7.1.02,14.03,12.05,10.020,24]tetracosa-1,3,5,7,9,11,14,16,18,20(24),22-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c3c(oc4c(-c5c6ccccc6c(-c6ccccc6)c6ccccc56)c5cccc6c5c(c43)C=CC6)c([2H])c2c1[2H] |
| InChI | InChI=1S/C43H26O/c1-2-12-26(13-3-1)38-30-18-6-8-20-32(30)40(33-21-9-7-19-31(33)38)42-35-23-11-17-27-16-10-22-34(39(27)35)41-36-24-28-14-4-5-15-29(28)25-37(36)44-43(41)42/h1-15,17-25H,16H2/i4D,5D,14D,15D,24D,25D |
| InChIKey | XFMBOFRZFBAYIF-BLWWSWSASA-N |
| XLogP | 12.10 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|