C11H9BrO — CID 176840971
1-bromo-3,4,5,6,7,8-hexadeuterio-2-methoxynaphthalene (PubChem CID 176840971) has the molecular formula C11H9BrO and a molecular weight of 243.13 g/mol. Its IUPAC name is 1-bromo-3,4,5,6,7,8-hexadeuterio-2-methoxynaphthalene.
| Compound Name | 1-bromo-3,4,5,6,7,8-hexadeuterio-2-methoxynaphthalene |
|---|---|
| PubChem CID | 176840971 |
| Molecular Formula | C11H9BrO |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 1-bromo-3,4,5,6,7,8-hexadeuterio-2-methoxynaphthalene |
| SMILES | [2H]c1c([2H])c([2H])c2c(Br)c(OC)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C11H9BrO/c1-13-10-7-6-8-4-2-3-5-9(8)11(10)12/h2-7H,1H3/i2D,3D,4D,5D,6D,7D |
| InChIKey | XNIGURFWNPLWJM-IAKNLNTOSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |