About 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine
4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine (PubChem CID 176841834) has the molecular formula C21H41FN2
and a molecular weight of 340.57 g/mol. Its IUPAC name is 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine |
| PubChem CID | 176841834 |
| Molecular Formula | C21H41FN2 |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine |
| SMILES | CC1CN(C(C)(C)C)CC(C)N1CC1CCC(C(C)(C)C)C(F)C1 |
| InChI | InChI=1S/C21H41FN2/c1-15-12-23(21(6,7)8)13-16(2)24(15)14-17-9-10-18(19(22)11-17)20(3,4)5/h15-19H,9-14H2,1-8H3 |
| InChIKey | MFXCSSGJNJEPDJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine?
The IUPAC name of 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine (CID 176841834) is 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine.
What is the SMILES notation for 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine?
The canonical SMILES for 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine is CC1CN(C(C)(C)C)CC(C)N1CC1CCC(C(C)(C)C)C(F)C1.
What is the InChIKey of 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine?
The InChIKey is MFXCSSGJNJEPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41FN2/c1-15-12-23(21(6,7)8)13-16(2)24(15)14-17-9-10-18(19(22)11-17)20(3,4)5/h15-19H,9-14H2,1-8H3.
What are the key properties of 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine?
4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine has a molecular weight of 340.57 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-[(4-tert-butyl-3-fluorocyclohexyl)methyl]-2,6-dimethylpiperazine is sourced from PubChem (CID 176841834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).