C26H31N3O2 — CID 176842246
N-[4-[8-[(5,7-dimethyl-1H-indol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decan-7-yl]phenyl]formamide (PubChem CID 176842246) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[4-[8-[(5,7-dimethyl-1H-indol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decan-7-yl]phenyl]formamide.
| Compound Name | N-[4-[8-[(5,7-dimethyl-1H-indol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decan-7-yl]phenyl]formamide |
|---|---|
| PubChem CID | 176842246 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[4-[8-[(5,7-dimethyl-1H-indol-4-yl)methyl]-1-oxa-8-azaspiro[4.5]decan-7-yl]phenyl]formamide |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCC2(CCCO2)CC1c1ccc(NC=O)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-18-14-19(2)25-22(8-11-27-25)23(18)16-29-12-10-26(9-3-13-31-26)15-24(29)20-4-6-21(7-5-20)28-17-30/h4-8,11,14,17,24,27H,3,9-10,12-13,15-16H2,1-2H3,(H,28,30) |
| InChIKey | GGIFZSQXLWOLFP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|