About 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one
2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one (PubChem CID 176842726) has the molecular formula C16H15FN2O2
and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one.
Molecular Properties
| Compound Name | 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one |
| PubChem CID | 176842726 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CCc2nc(-c3ccc(O)c(F)c3)ncc2C1=O |
| InChI | InChI=1S/C16H15FN2O2/c1-16(2)6-5-12-10(14(16)21)8-18-15(19-12)9-3-4-13(20)11(17)7-9/h3-4,7-8,20H,5-6H2,1-2H3 |
| InChIKey | QOLLQMLHMACRQK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one?
The IUPAC name of 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one (CID 176842726) is 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one.
What is the SMILES notation for 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one?
The canonical SMILES for 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one is CC1(C)CCc2nc(-c3ccc(O)c(F)c3)ncc2C1=O.
What is the InChIKey of 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one?
The InChIKey is QOLLQMLHMACRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O2/c1-16(2)6-5-12-10(14(16)21)8-18-15(19-12)9-3-4-13(20)11(17)7-9/h3-4,7-8,20H,5-6H2,1-2H3.
What are the key properties of 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one?
2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one has a molecular weight of 286.31 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-4-hydroxyphenyl)-6,6-dimethyl-7,8-dihydroquinazolin-5-one is sourced from PubChem (CID 176842726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).