C37H26N10 — CID 176842863
2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-4-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 176842863) has the molecular formula C37H26N10 and a molecular weight of 610.69 g/mol. Its IUPAC name is 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-4-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-4-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842863 |
| Molecular Formula | C37H26N10 |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-4-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(C)nc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6nc(C)nc(C)n6)c5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C37H26N10/c1-22-39-23(2)41-34(40-22)27-12-8-14-29(20-27)36-45-33(25-10-6-5-7-11-25)46-37(47-36)30-15-9-13-28(21-30)35-43-24(3)42-32(44-35)26-16-18-31(38-4)19-17-26/h5-21H,1-3H3 |
| InChIKey | WKMYAZJTWGCLKP-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 120.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|