C42H28N10 — CID 176842956
2-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 176842956) has the molecular formula C42H28N10 and a molecular weight of 672.76 g/mol. Its IUPAC name is 2-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842956 |
| Molecular Formula | C42H28N10 |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 2-[3-[4-(4-isocyanophenyl)-6-methyl-1,3,5-triazin-2-yl]phenyl]-4-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(C)nc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6nc(C)nc(-c7ccccc7)n6)c5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C42H28N10/c1-26-44-36(28-12-6-4-7-13-28)48-39(46-26)31-16-10-18-33(24-31)41-50-38(29-14-8-5-9-15-29)51-42(52-41)34-19-11-17-32(25-34)40-47-27(2)45-37(49-40)30-20-22-35(43-3)23-21-30/h4-25H,1-2H3 |
| InChIKey | CQBYOICELOYVQH-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 120.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|