C20H22F5IO4 — CID 176845252
[cyclohexanecarbonyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] cyclohexanecarboxylate (PubChem CID 176845252) has the molecular formula C20H22F5IO4 and a molecular weight of 548.29 g/mol. Its IUPAC name is [cyclohexanecarbonyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] cyclohexanecarboxylate.
| Compound Name | [cyclohexanecarbonyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 176845252 |
| Molecular Formula | C20H22F5IO4 |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [cyclohexanecarbonyloxy-(2,3,4,5,6-pentafluorophenyl)-λ3-iodanyl] cyclohexanecarboxylate |
| SMILES | O=C(OI(OC(=O)C1CCCCC1)c1c(F)c(F)c(F)c(F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C20H22F5IO4/c21-13-14(22)16(24)18(17(25)15(13)23)26(29-19(27)11-7-3-1-4-8-11)30-20(28)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | HOOBLFDUADSDTQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|