About [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate
[(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate (PubChem CID 176845302) has the molecular formula C14H18FIO4
and a molecular weight of 396.20 g/mol. Its IUPAC name is [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate |
| PubChem CID | 176845302 |
| Molecular Formula | C14H18FIO4 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OI(OC(=O)C(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FIO4/c1-9(2)13(17)19-16(20-14(18)10(3)4)12-7-5-11(15)6-8-12/h5-10H,1-4H3 |
| InChIKey | KHTNUCIWLSAFQZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate?
The IUPAC name of [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate (CID 176845302) is [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate.
What is the SMILES notation for [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate?
The canonical SMILES for [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate is CC(C)C(=O)OI(OC(=O)C(C)C)c1ccc(F)cc1.
What is the InChIKey of [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate?
The InChIKey is KHTNUCIWLSAFQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FIO4/c1-9(2)13(17)19-16(20-14(18)10(3)4)12-7-5-11(15)6-8-12/h5-10H,1-4H3.
What are the key properties of [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate?
[(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate has a molecular weight of 396.20 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-fluorophenyl)-(2-methylpropanoyloxy)-λ3-iodanyl] 2-methylpropanoate is sourced from PubChem (CID 176845302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).