C22H24ClFN4O4 — CID 176846748
N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(5-ethoxypyrazin-2-yl)-2-methylpropanamide (PubChem CID 176846748) has the molecular formula C22H24ClFN4O4 and a molecular weight of 462.91 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(5-ethoxypyrazin-2-yl)-2-methylpropanamide.
| Compound Name | N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(5-ethoxypyrazin-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176846748 |
| Molecular Formula | C22H24ClFN4O4 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(5-ethoxypyrazin-2-yl)-2-methylpropanamide |
| SMILES | CCOc1cnc(C(C)(C)C(=O)NCc2cc(F)c(C3CCC(=O)NC3=O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C22H24ClFN4O4/c1-4-32-18-11-25-16(10-26-18)22(2,3)21(31)27-9-12-7-14(23)19(15(24)8-12)13-5-6-17(29)28-20(13)30/h7-8,10-11,13H,4-6,9H2,1-3H3,(H,27,31)(H,28,29,30) |
| InChIKey | RGVALPUMCNVZFB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|