C22H23ClFN3O4 — CID 176846877
N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(6-methoxy-3-pyridinyl)-2-methylpropanamide (PubChem CID 176846877) has the molecular formula C22H23ClFN3O4 and a molecular weight of 447.89 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(6-methoxy-3-pyridinyl)-2-methylpropanamide.
| Compound Name | N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(6-methoxy-3-pyridinyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176846877 |
| Molecular Formula | C22H23ClFN3O4 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[[3-chloro-4-(2,6-dioxopiperidin-3-yl)-5-fluorophenyl]methyl]-2-(6-methoxy-3-pyridinyl)-2-methylpropanamide |
| SMILES | COc1ccc(C(C)(C)C(=O)NCc2cc(F)c(C3CCC(=O)NC3=O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C22H23ClFN3O4/c1-22(2,13-4-7-18(31-3)25-11-13)21(30)26-10-12-8-15(23)19(16(24)9-12)14-5-6-17(28)27-20(14)29/h4,7-9,11,14H,5-6,10H2,1-3H3,(H,26,30)(H,27,28,29) |
| InChIKey | PJXOZFWQMBZDDV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|