C22H20Cl2N4O3 — CID 176846888
2-(4-cyano-2-pyridinyl)-N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-methylpropanamide (PubChem CID 176846888) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 2-(4-cyano-2-pyridinyl)-N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | 2-(4-cyano-2-pyridinyl)-N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 176846888 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-(4-cyano-2-pyridinyl)-N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCc1cc(Cl)c(C2CCC(=O)NC2=O)c(Cl)c1)c1cc(C#N)ccn1 |
| InChI | InChI=1S/C22H20Cl2N4O3/c1-22(2,17-9-12(10-25)5-6-26-17)21(31)27-11-13-7-15(23)19(16(24)8-13)14-3-4-18(29)28-20(14)30/h5-9,14H,3-4,11H2,1-2H3,(H,27,31)(H,28,29,30) |
| InChIKey | KLYCYFJIHSWOOC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|