C26H73FO13Si13 — CID 176847629
3-(2-fluoroethoxy)propyl-tris[3-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silane (PubChem CID 176847629) has the molecular formula C26H73FO13Si13 and a molecular weight of 977.97 g/mol. Its IUPAC name is 3-(2-fluoroethoxy)propyl-tris[3-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silane.
| Compound Name | 3-(2-fluoroethoxy)propyl-tris[3-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silane |
|---|---|
| PubChem CID | 176847629 |
| Molecular Formula | C26H73FO13Si13 |
| Molecular Weight | 977.97 g/mol |
| Exact Mass | 976.20 |
| IUPAC Name | 3-(2-fluoroethoxy)propyl-tris[3-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCC[Si](CCCOCCF)(CCC[Si]2(C)O[SiH](C)O[SiH](C)O[SiH](C)O2)CCC[Si]2(C)O[SiH](C)O[SiH](C)O[SiH](C)O2)O[SiH](C)O1 |
| InChI | InChI=1S/C26H73FO13Si13/c1-41-29-44(4)35-50(10,36-45(5)30-41)20-14-24-53(23-13-18-28-19-17-27,25-15-21-51(11)37-46(6)31-42(2)32-47(7)38-51)26-16-22-52(12)39-48(8)33-43(3)34-49(9)40-52/h41-49H,13-26H2,1-12H3 |
| InChIKey | BHWQKNCSTSKVJZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|