About 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one
3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one (PubChem CID 176847697) has the molecular formula C4H5N3OS
and a molecular weight of 143.17 g/mol. Its IUPAC name is 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one |
| PubChem CID | 176847697 |
| Molecular Formula | C4H5N3OS |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(CS)[nH]1 |
| InChI | InChI=1S/C4H5N3OS/c8-4-1-5-7-3(2-9)6-4/h1,9H,2H2,(H,6,7,8) |
| InChIKey | UKIPNQDRBFMHOR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one?
The IUPAC name of 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one (CID 176847697) is 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one.
What is the SMILES notation for 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one?
The canonical SMILES for 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one is O=c1cnnc(CS)[nH]1.
What is the InChIKey of 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one?
The InChIKey is UKIPNQDRBFMHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3OS/c8-4-1-5-7-3(2-9)6-4/h1,9H,2H2,(H,6,7,8).
What are the key properties of 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one?
3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one has a molecular weight of 143.17 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(sulfanylmethyl)-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 176847697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).