C23H27ClN2O3S — CID 176848672
N-[1-[2-[2-(3-chlorophenyl)phenyl]cyclopropanecarbonyl]azepan-4-yl]methanesulfonamide (PubChem CID 176848672) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is N-[1-[2-[2-(3-chlorophenyl)phenyl]cyclopropanecarbonyl]azepan-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-[2-(3-chlorophenyl)phenyl]cyclopropanecarbonyl]azepan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 176848672 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[1-[2-[2-(3-chlorophenyl)phenyl]cyclopropanecarbonyl]azepan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)C2CC2c2ccccc2-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H27ClN2O3S/c1-30(28,29)25-18-8-5-12-26(13-11-18)23(27)22-15-21(22)20-10-3-2-9-19(20)16-6-4-7-17(24)14-16/h2-4,6-7,9-10,14,18,21-22,25H,5,8,11-13,15H2,1H3 |
| InChIKey | KGNGIWXNMYNCJJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |