C18H17N7OS — CID 176849229
(12-amino-7-pyrazin-2-yl-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl)-piperidin-1-ylmethanone (PubChem CID 176849229) has the molecular formula C18H17N7OS and a molecular weight of 379.45 g/mol. Its IUPAC name is (12-amino-7-pyrazin-2-yl-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl)-piperidin-1-ylmethanone.
| Compound Name | (12-amino-7-pyrazin-2-yl-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 176849229 |
| Molecular Formula | C18H17N7OS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (12-amino-7-pyrazin-2-yl-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl)-piperidin-1-ylmethanone |
| SMILES | Nc1c(C(=O)N2CCCCC2)sc2nc(-c3cnccn3)n3ccnc3c12 |
| InChI | InChI=1S/C18H17N7OS/c19-13-12-16-22-6-9-25(16)15(11-10-20-4-5-21-11)23-17(12)27-14(13)18(26)24-7-2-1-3-8-24/h4-6,9-10H,1-3,7-8,19H2 |
| InChIKey | ZZAQACUROPAWDC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |