C25H24O7 — CID 176849426
[3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 176849426) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 176849426 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(CCOc2ccc(OC(=O)/C=C/c3ccc(O)c(O)c3)cc2OC)cc1 |
| InChI | InChI=1S/C25H24O7/c1-29-19-7-3-17(4-8-19)13-14-31-23-11-9-20(16-24(23)30-2)32-25(28)12-6-18-5-10-21(26)22(27)15-18/h3-12,15-16,26-27H,13-14H2,1-2H3/b12-6+ |
| InChIKey | ZVIXGMISNMGBMX-WUXMJOGZSA-N |
| XLogP | 4.36 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|