About [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
[3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 176849426) has the molecular formula C25H24O7
and a molecular weight of 436.46 g/mol. Its IUPAC name is [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| PubChem CID | 176849426 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(CCOc2ccc(OC(=O)/C=C/c3ccc(O)c(O)c3)cc2OC)cc1 |
| InChI | InChI=1S/C25H24O7/c1-29-19-7-3-17(4-8-19)13-14-31-23-11-9-20(16-24(23)30-2)32-25(28)12-6-18-5-10-21(26)22(27)15-18/h3-12,15-16,26-27H,13-14H2,1-2H3/b12-6+ |
| InChIKey | ZVIXGMISNMGBMX-WUXMJOGZSA-N |
| XLogP | 4.36 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The IUPAC name of [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CID 176849426) is [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
What is the SMILES notation for [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The canonical SMILES for [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate is COc1ccc(CCOc2ccc(OC(=O)/C=C/c3ccc(O)c(O)c3)cc2OC)cc1.
What is the InChIKey of [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
The InChIKey is ZVIXGMISNMGBMX-WUXMJOGZSA-N. The full InChI is InChI=1S/C25H24O7/c1-29-19-7-3-17(4-8-19)13-14-31-23-11-9-20(16-24(23)30-2)32-25(28)12-6-18-5-10-21(26)22(27)15-18/h3-12,15-16,26-27H,13-14H2,1-2H3/b12-6+.
What are the key properties of [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate?
[3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate has a molecular weight of 436.46 g/mol, XLogP of 4.36, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methoxy-4-[2-(4-methoxyphenyl)ethoxy]phenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 176849426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).