C57H34N4S — CID 176849683
1,2,3,4,5,6,7,8-octadeuterio-9-[2-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)-3-triphenylen-2-ylphenyl]carbazole (PubChem CID 176849683) has the molecular formula C57H34N4S and a molecular weight of 815.04 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[2-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)-3-triphenylen-2-ylphenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[2-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)-3-triphenylen-2-ylphenyl]carbazole |
|---|---|
| PubChem CID | 176849683 |
| Molecular Formula | C57H34N4S |
| Molecular Weight | 815.04 g/mol |
| Exact Mass | 814.30 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[2-(4-dibenzothiophen-3-yl-6-phenyl-1,3,5-triazin-2-yl)-3-triphenylen-2-ylphenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cccc(-c2ccc3c4ccccc4c4ccccc4c3c2)c1-c1nc(-c2ccccc2)nc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C57H34N4S/c1-2-15-35(16-3-1)55-58-56(37-30-32-47-46-23-10-13-28-52(46)62-53(47)34-37)60-57(59-55)54-38(24-14-27-51(54)61-49-25-11-8-21-44(49)45-22-9-12-26-50(45)61)36-29-31-43-41-19-5-4-17-39(41)40-18-6-7-20-42(40)48(43)33-36/h1-34H/i8D,9D,11D,12D,21D,22D,25D,26D |
| InChIKey | OXUUBVHZEWVLDH-ZYPSYSOQSA-N |
| XLogP | 15.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.04 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|