C6H8N2O3 — CID 176850748
1,3-bis(trideuteriomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 176850748) has the molecular formula C6H8N2O3 and a molecular weight of 162.18 g/mol. Its IUPAC name is 1,3-bis(trideuteriomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis(trideuteriomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 176850748 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,3-bis(trideuteriomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | [2H]C([2H])([2H])N1C(=O)CC(=O)N(C([2H])([2H])[2H])C1=O |
| InChI | InChI=1S/C6H8N2O3/c1-7-4(9)3-5(10)8(2)6(7)11/h3H2,1-2H3/i1D3,2D3 |
| InChIKey | VVSASNKOFCZVES-WFGJKAKNSA-N |
| XLogP | -0.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|