C56H52N2Si — CID 176850851
22-(3,5-ditert-butylphenyl)-10-triphenylsilyl-20-azapentacyclo[19.4.0.02,7.08,13.014,19]pentacosa-1(21),2,4,6,8(13),9,11,14(19),15,17,22,24-dodecaen-18-amine (PubChem CID 176850851) has the molecular formula C56H52N2Si and a molecular weight of 781.13 g/mol. Its IUPAC name is 22-(3,5-ditert-butylphenyl)-10-triphenylsilyl-20-azapentacyclo[19.4.0.02,7.08,13.014,19]pentacosa-1(21),2,4,6,8(13),9,11,14(19),15,17,22,24-dodecaen-18-amine.
| Compound Name | 22-(3,5-ditert-butylphenyl)-10-triphenylsilyl-20-azapentacyclo[19.4.0.02,7.08,13.014,19]pentacosa-1(21),2,4,6,8(13),9,11,14(19),15,17,22,24-dodecaen-18-amine |
|---|---|
| PubChem CID | 176850851 |
| Molecular Formula | C56H52N2Si |
| Molecular Weight | 781.13 g/mol |
| Exact Mass | 780.39 |
| IUPAC Name | 22-(3,5-ditert-butylphenyl)-10-triphenylsilyl-20-azapentacyclo[19.4.0.02,7.08,13.014,19]pentacosa-1(21),2,4,6,8(13),9,11,14(19),15,17,22,24-dodecaen-18-amine |
| SMILES | CC(C)(C)c1cc(-c2cccc3c2[nH]c2c(N)cccc2c2ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc2c2ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H52N2Si/c1-55(2,3)39-34-38(35-40(36-39)56(4,5)6)45-28-18-29-49-46-26-16-17-27-47(46)51-37-44(32-33-48(51)50-30-19-31-52(57)54(50)58-53(45)49)59(41-20-10-7-11-21-41,42-22-12-8-13-23-42)43-24-14-9-15-25-43/h7-37,58H,57H2,1-6H3 |
| InChIKey | FJMRJHJWWUUTQB-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.13 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|