About methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate
methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate (PubChem CID 176851931) has the molecular formula C13H14F2N2O2
and a molecular weight of 268.26 g/mol. Its IUPAC name is methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate |
| PubChem CID | 176851931 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C2=CCC(F)(F)CC2)nc1N |
| InChI | InChI=1S/C13H14F2N2O2/c1-19-12(18)9-2-3-10(17-11(9)16)8-4-6-13(14,15)7-5-8/h2-4H,5-7H2,1H3,(H2,16,17) |
| InChIKey | LVWAWTFTZCUNLY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate?
The IUPAC name of methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate (CID 176851931) is methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate?
The canonical SMILES for methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate is COC(=O)c1ccc(C2=CCC(F)(F)CC2)nc1N.
What is the InChIKey of methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate?
The InChIKey is LVWAWTFTZCUNLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O2/c1-19-12(18)9-2-3-10(17-11(9)16)8-4-6-13(14,15)7-5-8/h2-4H,5-7H2,1H3,(H2,16,17).
What are the key properties of methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate?
methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate has a molecular weight of 268.26 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-6-(4,4-difluorocyclohexen-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 176851931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).