About (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one
(5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one (PubChem CID 176853024) has the molecular formula C7H11ClN2O3
and a molecular weight of 206.63 g/mol. Its IUPAC name is (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one.
Molecular Properties
| Compound Name | (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one |
| PubChem CID | 176853024 |
| Molecular Formula | C7H11ClN2O3 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1NC[C@@]2(COCCN(Cl)C2)O1 |
| InChI | InChI=1S/C7H11ClN2O3/c8-10-1-2-12-5-7(4-10)3-9-6(11)13-7/h1-5H2,(H,9,11)/t7-/m1/s1 |
| InChIKey | WOPNGUHJTWTYLG-SSDOTTSWSA-N |
| XLogP | -0.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one?
The IUPAC name of (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one (CID 176853024) is (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one.
What is the SMILES notation for (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one?
The canonical SMILES for (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one is O=C1NC[C@@]2(COCCN(Cl)C2)O1.
What is the InChIKey of (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one?
The InChIKey is WOPNGUHJTWTYLG-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H11ClN2O3/c8-10-1-2-12-5-7(4-10)3-9-6(11)13-7/h1-5H2,(H,9,11)/t7-/m1/s1.
What are the key properties of (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one?
(5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one has a molecular weight of 206.63 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-7-chloro-1,10-dioxa-3,7-diazaspiro[4.6]undecan-2-one is sourced from PubChem (CID 176853024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).