C29H29N — CID 176854873
3-tert-butyl-N-(4-methylphenyl)-N-(4-phenylphenyl)aniline (PubChem CID 176854873) has the molecular formula C29H29N and a molecular weight of 391.56 g/mol. Its IUPAC name is 3-tert-butyl-N-(4-methylphenyl)-N-(4-phenylphenyl)aniline.
| Compound Name | 3-tert-butyl-N-(4-methylphenyl)-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 176854873 |
| Molecular Formula | C29H29N |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-tert-butyl-N-(4-methylphenyl)-N-(4-phenylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(-c3ccccc3)cc2)c2cccc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C29H29N/c1-22-13-17-26(18-14-22)30(28-12-8-11-25(21-28)29(2,3)4)27-19-15-24(16-20-27)23-9-6-5-7-10-23/h5-21H,1-4H3 |
| InChIKey | OJGVCOPBUVYEJF-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |