C46H60F2N4S2 — CID 176857146
2,15-difluoro-13,13,26,26-tetrahexyl-10,23-dimethyl-7,20-dithia-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1,3(14),4(12),5,8,10,15,17(25),18,21,23-undecaene (PubChem CID 176857146) has the molecular formula C46H60F2N4S2 and a molecular weight of 771.14 g/mol. Its IUPAC name is 2,15-difluoro-13,13,26,26-tetrahexyl-10,23-dimethyl-7,20-dithia-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1,3(14),4(12),5,8,10,15,17(25),18,21,23-undecaene.
| Compound Name | 2,15-difluoro-13,13,26,26-tetrahexyl-10,23-dimethyl-7,20-dithia-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1,3(14),4(12),5,8,10,15,17(25),18,21,23-undecaene |
|---|---|
| PubChem CID | 176857146 |
| Molecular Formula | C46H60F2N4S2 |
| Molecular Weight | 771.14 g/mol |
| Exact Mass | 770.42 |
| IUPAC Name | 2,15-difluoro-13,13,26,26-tetrahexyl-10,23-dimethyl-7,20-dithia-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1,3(14),4(12),5,8,10,15,17(25),18,21,23-undecaene |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)c3nsnc3c2-c2c(F)c3c(c(F)c21)-c1c(cc(C)c2nsnc12)C3(CCCCCC)CCCCCC |
| InChI | InChI=1S/C46H60F2N4S2/c1-7-11-15-19-23-45(24-20-16-12-8-2)31-27-29(5)41-43(51-53-49-41)33(31)35-37(45)39(47)36-34-32(28-30(6)42-44(34)52-54-50-42)46(38(36)40(35)48,25-21-17-13-9-3)26-22-18-14-10-4/h27-28H,7-26H2,1-6H3 |
| InChIKey | SJFNHBNAGYLAGJ-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.14 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|