C28H38S2Si2 — CID 176857478
9,9,18,18-tetraethyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-disilapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene (PubChem CID 176857478) has the molecular formula C28H38S2Si2 and a molecular weight of 494.92 g/mol. Its IUPAC name is 9,9,18,18-tetraethyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-disilapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene.
| Compound Name | 9,9,18,18-tetraethyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-disilapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
|---|---|
| PubChem CID | 176857478 |
| Molecular Formula | C28H38S2Si2 |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 9,9,18,18-tetraethyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-disilapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
| SMILES | CC[Si]1(CC)c2cc3c(cc2-c2sc(C(C)C)cc21)[Si](CC)(CC)c1cc(C(C)C)sc1-3 |
| InChI | InChI=1S/C28H38S2Si2/c1-9-31(10-2)23-13-20-24(14-19(23)27-25(31)15-21(29-27)17(5)6)32(11-3,12-4)26-16-22(18(7)8)30-28(20)26/h13-18H,9-12H2,1-8H3 |
| InChIKey | AZCLJEWGBLQHDO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|