C52H72Br2N4Se2 — CID 176857540
10,23-dibromo-13,13,26,26-tetraoctyl-7,20-diselena-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1(16),2,4(12),5,8,10,14,17(25),18,21,23-undecaene (PubChem CID 176857540) has the molecular formula C52H72Br2N4Se2 and a molecular weight of 1070.90 g/mol. Its IUPAC name is 10,23-dibromo-13,13,26,26-tetraoctyl-7,20-diselena-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1(16),2,4(12),5,8,10,14,17(25),18,21,23-undecaene.
| Compound Name | 10,23-dibromo-13,13,26,26-tetraoctyl-7,20-diselena-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1(16),2,4(12),5,8,10,14,17(25),18,21,23-undecaene |
|---|---|
| PubChem CID | 176857540 |
| Molecular Formula | C52H72Br2N4Se2 |
| Molecular Weight | 1070.90 g/mol |
| Exact Mass | 1070.25 |
| IUPAC Name | 10,23-dibromo-13,13,26,26-tetraoctyl-7,20-diselena-6,8,19,21-tetrazaheptacyclo[14.10.0.03,14.04,12.05,9.017,25.018,22]hexacosa-1(16),2,4(12),5,8,10,14,17(25),18,21,23-undecaene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc3c(cc2-c2c1cc(Br)c1n[se]nc21)C(CCCCCCCC)(CCCCCCCC)c1cc(Br)c2n[se]nc2c1-3 |
| InChI | InChI=1S/C52H72Br2N4Se2/c1-5-9-13-17-21-25-29-51(30-26-22-18-14-10-6-2)39-33-38-40(34-37(39)45-41(51)35-43(53)47-49(45)57-59-55-47)52(31-27-23-19-15-11-7-3,32-28-24-20-16-12-8-4)42-36-44(54)48-50(46(38)42)58-60-56-48/h33-36H,5-32H2,1-4H3 |
| InChIKey | IGZZKIMVONOOMQ-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.90 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|