C30H40N2S2 — CID 176857688
9,18-dipentyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene (PubChem CID 176857688) has the molecular formula C30H40N2S2 and a molecular weight of 492.80 g/mol. Its IUPAC name is 9,18-dipentyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene.
| Compound Name | 9,18-dipentyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
|---|---|
| PubChem CID | 176857688 |
| Molecular Formula | C30H40N2S2 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 9,18-dipentyl-6,15-di(propan-2-yl)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
| SMILES | CCCCCn1c2cc3c4sc(C(C)C)cc4n(CCCCC)c3cc2c2sc(C(C)C)cc21 |
| InChI | InChI=1S/C30H40N2S2/c1-7-9-11-13-31-23-15-22-24(16-21(23)29-25(31)17-27(33-29)19(3)4)32(14-12-10-8-2)26-18-28(20(5)6)34-30(22)26/h15-20H,7-14H2,1-6H3 |
| InChIKey | TXMWWWIWWHJDCI-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|