C38H40N4O8 — CID 176858068
7,18-bis[3-[bis(2-hydroxyethyl)amino]propyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 176858068) has the molecular formula C38H40N4O8 and a molecular weight of 680.76 g/mol. Its IUPAC name is 7,18-bis[3-[bis(2-hydroxyethyl)amino]propyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis[3-[bis(2-hydroxyethyl)amino]propyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 176858068 |
| Molecular Formula | C38H40N4O8 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | 7,18-bis[3-[bis(2-hydroxyethyl)amino]propyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1CCCN(CCO)CCO)c64)C(=O)N(CCCN(CCO)CCO)C5=O |
| InChI | InChI=1S/C38H40N4O8/c43-19-15-39(16-20-44)11-1-13-41-35(47)27-7-3-23-25-5-9-29-34-30(38(50)42(37(29)49)14-2-12-40(17-21-45)18-22-46)10-6-26(32(25)34)24-4-8-28(36(41)48)33(27)31(23)24/h3-10,43-46H,1-2,11-22H2 |
| InChIKey | PRUGQXMAPHUHNA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|