C18H12N8OS — CID 176859622
N-[4-(6-prop-1-ynyl-2-pyridinyl)-1,3-thiazol-2-yl]-3-pyrimidin-5-yltriazole-4-carboxamide (PubChem CID 176859622) has the molecular formula C18H12N8OS and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[4-(6-prop-1-ynyl-2-pyridinyl)-1,3-thiazol-2-yl]-3-pyrimidin-5-yltriazole-4-carboxamide.
| Compound Name | N-[4-(6-prop-1-ynyl-2-pyridinyl)-1,3-thiazol-2-yl]-3-pyrimidin-5-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 176859622 |
| Molecular Formula | C18H12N8OS |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[4-(6-prop-1-ynyl-2-pyridinyl)-1,3-thiazol-2-yl]-3-pyrimidin-5-yltriazole-4-carboxamide |
| SMILES | CC#Cc1cccc(-c2csc(NC(=O)c3cnnn3-c3cncnc3)n2)n1 |
| InChI | InChI=1S/C18H12N8OS/c1-2-4-12-5-3-6-14(22-12)15-10-28-18(23-15)24-17(27)16-9-21-25-26(16)13-7-19-11-20-8-13/h3,5-11H,1H3,(H,23,24,27) |
| InChIKey | XDYLTWPSSKWUHH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|