About 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine
2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine (PubChem CID 176860175) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine |
| PubChem CID | 176860175 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine |
| SMILES | CN1C(C(C)(C)C)=NC2C=NC=CC21 |
| InChI | InChI=1S/C11H17N3/c1-11(2,3)10-13-8-7-12-6-5-9(8)14(10)4/h5-9H,1-4H3 |
| InChIKey | GRYMFVCRIQJKRF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The IUPAC name of 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine (CID 176860175) is 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine.
What is the SMILES notation for 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The canonical SMILES for 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine is CN1C(C(C)(C)C)=NC2C=NC=CC21.
What is the InChIKey of 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
The InChIKey is GRYMFVCRIQJKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-11(2,3)10-13-8-7-12-6-5-9(8)14(10)4/h5-9H,1-4H3.
What are the key properties of 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine?
2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine has a molecular weight of 191.28 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-methyl-3a,7a-dihydroimidazo[4,5-c]pyridine is sourced from PubChem (CID 176860175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).