C14H16F3NO2S — CID 176861733
(NZ,R)-N-[4-(difluoromethoxy)-5-fluoro-2,3-dihydroinden-1-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 176861733) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is (NZ,R)-N-[4-(difluoromethoxy)-5-fluoro-2,3-dihydroinden-1-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[4-(difluoromethoxy)-5-fluoro-2,3-dihydroinden-1-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 176861733 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (NZ,R)-N-[4-(difluoromethoxy)-5-fluoro-2,3-dihydroinden-1-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C1/CCc2c1ccc(F)c2OC(F)F |
| InChI | InChI=1S/C14H16F3NO2S/c1-14(2,3)21(19)18-11-7-5-9-8(11)4-6-10(15)12(9)20-13(16)17/h4,6,13H,5,7H2,1-3H3/b18-11-/t21-/m1/s1 |
| InChIKey | ANHAXZAGYJTNGO-PETIARSGSA-N |
| XLogP | 3.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|