About N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+)
N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) (PubChem CID 176862930) has the molecular formula C10H13NW
and a molecular weight of 331.06 g/mol. Its IUPAC name is N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+).
Molecular Properties
| Compound Name | N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) |
| PubChem CID | 176862930 |
| Molecular Formula | C10H13NW |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) |
| SMILES | [CH2-]CN([CH2-])c1ccccc1C.[W+2] |
| InChI | InChI=1S/C10H13N.W/c1-4-11(3)10-8-6-5-7-9(10)2;/h5-8H,1,3-4H2,2H3;/q-2;+2 |
| InChIKey | MNPLTDZEJPHGAT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+)?
The IUPAC name of N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) (CID 176862930) is N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+).
What is the SMILES notation for N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+)?
The canonical SMILES for N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) is [CH2-]CN([CH2-])c1ccccc1C.[W+2].
What is the InChIKey of N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+)?
The InChIKey is MNPLTDZEJPHGAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.W/c1-4-11(3)10-8-6-5-7-9(10)2;/h5-8H,1,3-4H2,2H3;/q-2;+2.
What are the key properties of N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+)?
N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) has a molecular weight of 331.06 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methanidyl-2-methylaniline;tungsten(2+) is sourced from PubChem (CID 176862930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).