About 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one
8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one (PubChem CID 176865083) has the molecular formula C16H16BrF2NO2
and a molecular weight of 372.21 g/mol. Its IUPAC name is 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one |
| PubChem CID | 176865083 |
| Molecular Formula | C16H16BrF2NO2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one |
| SMILES | Cc1cc(Br)c2oc(N3CCC(F)(F)CC3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C16H16BrF2NO2/c1-9-7-11-13(21)10(2)15(22-14(11)12(17)8-9)20-5-3-16(18,19)4-6-20/h7-8H,3-6H2,1-2H3 |
| InChIKey | MKRSUIZIGGAFFW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one?
The IUPAC name of 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one (CID 176865083) is 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one.
What is the SMILES notation for 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one?
The canonical SMILES for 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one is Cc1cc(Br)c2oc(N3CCC(F)(F)CC3)c(C)c(=O)c2c1.
What is the InChIKey of 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one?
The InChIKey is MKRSUIZIGGAFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrF2NO2/c1-9-7-11-13(21)10(2)15(22-14(11)12(17)8-9)20-5-3-16(18,19)4-6-20/h7-8H,3-6H2,1-2H3.
What are the key properties of 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one?
8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one has a molecular weight of 372.21 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-(4,4-difluoropiperidin-1-yl)-3,6-dimethylchromen-4-one is sourced from PubChem (CID 176865083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).