C53H48N2O — CID 176865604
1-(1,1,3,3,5,5,7,7-octamethyl-8-phenyl-2,6-dihydro-s-indacen-4-yl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole (PubChem CID 176865604) has the molecular formula C53H48N2O and a molecular weight of 728.98 g/mol. Its IUPAC name is 1-(1,1,3,3,5,5,7,7-octamethyl-8-phenyl-2,6-dihydro-s-indacen-4-yl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole.
| Compound Name | 1-(1,1,3,3,5,5,7,7-octamethyl-8-phenyl-2,6-dihydro-s-indacen-4-yl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole |
|---|---|
| PubChem CID | 176865604 |
| Molecular Formula | C53H48N2O |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | 1-(1,1,3,3,5,5,7,7-octamethyl-8-phenyl-2,6-dihydro-s-indacen-4-yl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole |
| SMILES | CC1(C)CC(C)(C)c2c(-n3c(-c4cccc5c4oc4cc6c(ccc7ccccc76)cc45)nc4ccccc43)c3c(c(-c4ccccc4)c21)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C53H48N2O/c1-50(2)29-52(5,6)45-43(50)42(32-18-10-9-11-19-32)44-46(53(7,8)30-51(44,3)4)47(45)55-40-24-15-14-23-39(40)54-49(55)36-22-16-21-35-38-27-33-26-25-31-17-12-13-20-34(31)37(33)28-41(38)56-48(35)36/h9-28H,29-30H2,1-8H3 |
| InChIKey | AUTCCHJISRPOFD-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|