C25H28N2OSSi — CID 176865734
12-oxa-15-thia-17,19-diazapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2,4,6,8,10,13,16,18-nonaen-14-yl-tri(propan-2-yl)silane (PubChem CID 176865734) has the molecular formula C25H28N2OSSi and a molecular weight of 432.67 g/mol. Its IUPAC name is 12-oxa-15-thia-17,19-diazapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2,4,6,8,10,13,16,18-nonaen-14-yl-tri(propan-2-yl)silane.
| Compound Name | 12-oxa-15-thia-17,19-diazapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2,4,6,8,10,13,16,18-nonaen-14-yl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 176865734 |
| Molecular Formula | C25H28N2OSSi |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 12-oxa-15-thia-17,19-diazapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(20),2,4,6,8,10,13,16,18-nonaen-14-yl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](c1sc2ncnc3c2c1Oc1cc2ccccc2cc1-3)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H28N2OSSi/c1-14(2)30(15(3)4,16(5)6)25-23-21-22(26-13-27-24(21)29-25)19-11-17-9-7-8-10-18(17)12-20(19)28-23/h7-16H,1-6H3 |
| InChIKey | GASUFADPJZIZGL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|