About N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide
N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide (PubChem CID 176865985) has the molecular formula C8H11ClN2OS
and a molecular weight of 218.71 g/mol. Its IUPAC name is N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide |
| PubChem CID | 176865985 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide |
| SMILES | Cc1sc(NC(=O)C(C)C)nc1Cl |
| InChI | InChI=1S/C8H11ClN2OS/c1-4(2)7(12)11-8-10-6(9)5(3)13-8/h4H,1-3H3,(H,10,11,12) |
| InChIKey | FPUZPETZRQRDDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide?
The IUPAC name of N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide (CID 176865985) is N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide.
What is the SMILES notation for N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide?
The canonical SMILES for N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide is Cc1sc(NC(=O)C(C)C)nc1Cl.
What is the InChIKey of N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide?
The InChIKey is FPUZPETZRQRDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2OS/c1-4(2)7(12)11-8-10-6(9)5(3)13-8/h4H,1-3H3,(H,10,11,12).
What are the key properties of N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide?
N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide has a molecular weight of 218.71 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-5-methyl-1,3-thiazol-2-yl)-2-methylpropanamide is sourced from PubChem (CID 176865985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).