About 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide
4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide (PubChem CID 176866006) has the molecular formula C7H10N2OS
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 176866006 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C7H10N2OS/c1-4-5(2)11-7(9-4)6(10)8-3/h1-3H3,(H,8,10)/i3D3 |
| InChIKey | CDKPWVXSGKZMLK-HPRDVNIFSA-N |
| XLogP | 1.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide (CID 176866006) is 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide is [2H]C([2H])([2H])NC(=O)c1nc(C)c(C)s1.
What is the InChIKey of 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide?
The InChIKey is CDKPWVXSGKZMLK-HPRDVNIFSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-4-5(2)11-7(9-4)6(10)8-3/h1-3H3,(H,8,10)/i3D3.
What are the key properties of 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide?
4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide has a molecular weight of 173.26 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(trideuteriomethyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 176866006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).