C22H26ClN7O2S — CID 176866456
[1-[[2-[2-(5-chloropyrimidin-2-yl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol (PubChem CID 176866456) has the molecular formula C22H26ClN7O2S and a molecular weight of 488.02 g/mol. Its IUPAC name is [1-[[2-[2-(5-chloropyrimidin-2-yl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [1-[[2-[2-(5-chloropyrimidin-2-yl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 176866456 |
| Molecular Formula | C22H26ClN7O2S |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [1-[[2-[2-(5-chloropyrimidin-2-yl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
| SMILES | O=S1CCCc2nc(N3CC4=C(CN(c5ncc(Cl)cn5)C4)C3)nc(NC3(CO)CCC3)c21 |
| InChI | InChI=1S/C22H26ClN7O2S/c23-16-7-24-20(25-8-16)29-9-14-11-30(12-15(14)10-29)21-26-17-3-1-6-33(32)18(17)19(27-21)28-22(13-31)4-2-5-22/h7-8,31H,1-6,9-13H2,(H,26,27,28) |
| InChIKey | AGRRWKFQSLFREH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|