C23H27N9OS — CID 176866861
2-[[1-[[(5R)-2-[4-(5-ethynylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methyl]guanidine (PubChem CID 176866861) has the molecular formula C23H27N9OS and a molecular weight of 477.60 g/mol. Its IUPAC name is 2-[[1-[[(5R)-2-[4-(5-ethynylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methyl]guanidine.
| Compound Name | 2-[[1-[[(5R)-2-[4-(5-ethynylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methyl]guanidine |
|---|---|
| PubChem CID | 176866861 |
| Molecular Formula | C23H27N9OS |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[[1-[[(5R)-2-[4-(5-ethynylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methyl]guanidine |
| SMILES | C#Cc1cnc(C2=CCN(c3nc4c(c(NC5(CN=C(N)N)CCC5)n3)[S@](=O)CC4)CC2)nc1 |
| InChI | InChI=1S/C23H27N9OS/c1-2-15-12-26-19(27-13-15)16-4-9-32(10-5-16)22-29-17-6-11-34(33)18(17)20(30-22)31-23(7-3-8-23)14-28-21(24)25/h1,4,12-13H,3,5-11,14H2,(H4,24,25,28)(H,29,30,31)/t34-/m1/s1 |
| InChIKey | LYEMSHXVRPXTMO-UUWRZZSWSA-N |
| XLogP | 0.81 |
| TPSA | 148.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|