C26H26F5N5OS2 — CID 176867577
2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-N-[3-(pentafluoro-λ6-sulfanyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 176867577) has the molecular formula C26H26F5N5OS2 and a molecular weight of 583.65 g/mol. Its IUPAC name is 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-N-[3-(pentafluoro-λ6-sulfanyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-N-[3-(pentafluoro-λ6-sulfanyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176867577 |
| Molecular Formula | C26H26F5N5OS2 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-oxo-N-[3-(pentafluoro-λ6-sulfanyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | O=S1CCc2nc(N3CC4CN(c5ccc6c(c5)CC6)CC4C3)nc(Nc3cccc(S(F)(F)(F)(F)F)c3)c21 |
| InChI | InChI=1S/C26H26F5N5OS2/c27-39(28,29,30,31)22-3-1-2-20(11-22)32-25-24-23(8-9-38(24)37)33-26(34-25)36-14-18-12-35(13-19(18)15-36)21-7-6-16-4-5-17(16)10-21/h1-3,6-7,10-11,18-19H,4-5,8-9,12-15H2,(H,32,33,34) |
| InChIKey | JBEGSFAICWBLTM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|