C15H21NSi — CID 176867954
4-(2,2-dimethyl-1,3-dihydro-2-benzosilol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 176867954) has the molecular formula C15H21NSi and a molecular weight of 243.43 g/mol. Its IUPAC name is 4-(2,2-dimethyl-1,3-dihydro-2-benzosilol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2,2-dimethyl-1,3-dihydro-2-benzosilol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 176867954 |
| Molecular Formula | C15H21NSi |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-(2,2-dimethyl-1,3-dihydro-2-benzosilol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C[Si]1(C)Cc2ccc(C3=CCNCC3)cc2C1 |
| InChI | InChI=1S/C15H21NSi/c1-17(2)10-14-4-3-13(9-15(14)11-17)12-5-7-16-8-6-12/h3-5,9,16H,6-8,10-11H2,1-2H3 |
| InChIKey | PXJWIOYVKZLLFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|