C21H27ClN6O2S — CID 176867982
[1-[[2-[5-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-[(R)-methylsulfinyl]pyrimidin-4-yl]amino]cyclobutyl]methanol (PubChem CID 176867982) has the molecular formula C21H27ClN6O2S and a molecular weight of 463.01 g/mol. Its IUPAC name is [1-[[2-[5-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-[(R)-methylsulfinyl]pyrimidin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [1-[[2-[5-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-[(R)-methylsulfinyl]pyrimidin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 176867982 |
| Molecular Formula | C21H27ClN6O2S |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [1-[[2-[5-(5-chloropyrimidin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-[(R)-methylsulfinyl]pyrimidin-4-yl]amino]cyclobutyl]methanol |
| SMILES | C[S@@](=O)c1cnc(N2CC3CC(c4ncc(Cl)cn4)CC3C2)nc1NC1(CO)CCC1 |
| InChI | InChI=1S/C21H27ClN6O2S/c1-31(30)17-9-25-20(26-19(17)27-21(12-29)3-2-4-21)28-10-14-5-13(6-15(14)11-28)18-23-7-16(22)8-24-18/h7-9,13-15,29H,2-6,10-12H2,1H3,(H,25,26,27)/t13?,14?,15?,31-/m1/s1 |
| InChIKey | MQVCVWUBNCALOO-HHAZDBKHSA-N |
| XLogP | 2.61 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |