C27H36N4O2S — CID 176868149
[1-[[2-[4-(2,3-dihydro-1H-inden-5-yl)piperidin-1-yl]-5-oxo-6,7,8,9-tetrahydrothiepino[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol (PubChem CID 176868149) has the molecular formula C27H36N4O2S and a molecular weight of 480.68 g/mol. Its IUPAC name is [1-[[2-[4-(2,3-dihydro-1H-inden-5-yl)piperidin-1-yl]-5-oxo-6,7,8,9-tetrahydrothiepino[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [1-[[2-[4-(2,3-dihydro-1H-inden-5-yl)piperidin-1-yl]-5-oxo-6,7,8,9-tetrahydrothiepino[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 176868149 |
| Molecular Formula | C27H36N4O2S |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | [1-[[2-[4-(2,3-dihydro-1H-inden-5-yl)piperidin-1-yl]-5-oxo-6,7,8,9-tetrahydrothiepino[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
| SMILES | O=S1CCCCc2nc(N3CCC(c4ccc5c(c4)CCC5)CC3)nc(NC3(CO)CCC3)c21 |
| InChI | InChI=1S/C27H36N4O2S/c32-18-27(12-4-13-27)30-25-24-23(7-1-2-16-34(24)33)28-26(29-25)31-14-10-20(11-15-31)22-9-8-19-5-3-6-21(19)17-22/h8-9,17,20,32H,1-7,10-16,18H2,(H,28,29,30) |
| InChIKey | QOANREZGOMTMCT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |