C13H15N3 — CID 176868239
3-(1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-2,4-diazabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 176868239) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-2,4-diazabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 3-(1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-2,4-diazabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 176868239 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-(1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl)-2,4-diazabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | C1=C(c2ncc3c(n2)CC3)CC2CNCC12 |
| InChI | InChI=1S/C13H15N3/c1-2-12-8(1)7-15-13(16-12)9-3-10-5-14-6-11(10)4-9/h3,7,10-11,14H,1-2,4-6H2 |
| InChIKey | QEJRRRCFDIPBBS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |