C17H26N4O2S — CID 176868318
2-tert-butyl-N-[1-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclobutyl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 176868318) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-tert-butyl-N-[1-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclobutyl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-N-[1-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclobutyl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176868318 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-tert-butyl-N-[1-[(E)-N-methoxy-C-methylcarbonimidoyl]cyclobutyl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | CO/N=C(\C)C1(Nc2nc(C(C)(C)C)nc3c2S(=O)CC3)CCC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-11(21-23-5)17(8-6-9-17)20-14-13-12(7-10-24(13)22)18-15(19-14)16(2,3)4/h6-10H2,1-5H3,(H,18,19,20)/b21-11+ |
| InChIKey | URKUHDFVIKAAIM-SRZZPIQSSA-N |
| XLogP | 2.79 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|