C37H32N4+2 — CID 176869753
spiro[2,15-diaza-5,12-diazoniahexacyclo[20.3.1.12,5.112,15.116,20.06,11]nonacosa-1(25),3,5(29),12(28),13,16,18,20(27),22(26),23-decaene-21,9'-fluorene] (PubChem CID 176869753) has the molecular formula C37H32N4+2 and a molecular weight of 532.69 g/mol. Its IUPAC name is spiro[2,15-diaza-5,12-diazoniahexacyclo[20.3.1.12,5.112,15.116,20.06,11]nonacosa-1(25),3,5(29),12(28),13,16,18,20(27),22(26),23-decaene-21,9'-fluorene].
| Compound Name | spiro[2,15-diaza-5,12-diazoniahexacyclo[20.3.1.12,5.112,15.116,20.06,11]nonacosa-1(25),3,5(29),12(28),13,16,18,20(27),22(26),23-decaene-21,9'-fluorene] |
|---|---|
| PubChem CID | 176869753 |
| Molecular Formula | C37H32N4+2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | spiro[2,15-diaza-5,12-diazoniahexacyclo[20.3.1.12,5.112,15.116,20.06,11]nonacosa-1(25),3,5(29),12(28),13,16,18,20(27),22(26),23-decaene-21,9'-fluorene] |
| SMILES | c1cc2cc(c1)C1(c3cccc(c3)-n3cc[n+](c3)C3CCCCC3[n+]3ccn-2c3)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H32N4/c1-3-15-33-31(13-1)32-14-2-4-16-34(32)37(33)27-9-7-11-29(23-27)38-19-21-40(25-38)35-17-5-6-18-36(35)41-22-20-39(26-41)30-12-8-10-28(37)24-30/h1-4,7-16,19-26,35-36H,5-6,17-18H2/q+2 |
| InChIKey | SVBUFRDRDWPTIS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|