About 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one
5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one (PubChem CID 176871779) has the molecular formula C8H15NO3S
and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one.
Molecular Properties
| Compound Name | 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one |
| PubChem CID | 176871779 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one |
| SMILES | CC(C)N1C(=O)CS(=O)(=O)CC1C |
| InChI | InChI=1S/C8H15NO3S/c1-6(2)9-7(3)4-13(11,12)5-8(9)10/h6-7H,4-5H2,1-3H3 |
| InChIKey | PFZZSPJXXOHOEM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one?
The IUPAC name of 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one (CID 176871779) is 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one.
What is the SMILES notation for 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one?
The canonical SMILES for 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one is CC(C)N1C(=O)CS(=O)(=O)CC1C.
What is the InChIKey of 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one?
The InChIKey is PFZZSPJXXOHOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3S/c1-6(2)9-7(3)4-13(11,12)5-8(9)10/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one?
5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one has a molecular weight of 205.28 g/mol, XLogP of 0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,1-dioxo-4-propan-2-yl-1,4-thiazinan-3-one is sourced from PubChem (CID 176871779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).