C21H25FN6O2 — CID 176871807
6-(3-fluorophenyl)-N'-(1-hydroxypropan-2-yl)-2-(1-methylpyrazol-4-yl)-N'-propan-2-ylpyrimidine-4-carbohydrazide (PubChem CID 176871807) has the molecular formula C21H25FN6O2 and a molecular weight of 412.47 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-N'-(1-hydroxypropan-2-yl)-2-(1-methylpyrazol-4-yl)-N'-propan-2-ylpyrimidine-4-carbohydrazide.
| Compound Name | 6-(3-fluorophenyl)-N'-(1-hydroxypropan-2-yl)-2-(1-methylpyrazol-4-yl)-N'-propan-2-ylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 176871807 |
| Molecular Formula | C21H25FN6O2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 6-(3-fluorophenyl)-N'-(1-hydroxypropan-2-yl)-2-(1-methylpyrazol-4-yl)-N'-propan-2-ylpyrimidine-4-carbohydrazide |
| SMILES | CC(C)N(NC(=O)c1cc(-c2cccc(F)c2)nc(-c2cnn(C)c2)n1)C(C)CO |
| InChI | InChI=1S/C21H25FN6O2/c1-13(2)28(14(3)12-29)26-21(30)19-9-18(15-6-5-7-17(22)8-15)24-20(25-19)16-10-23-27(4)11-16/h5-11,13-14,29H,12H2,1-4H3,(H,26,30) |
| InChIKey | ZYJBKQYVDBAGHY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|