About 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate
2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate (PubChem CID 176872446) has the molecular formula C46H90N2O5
and a molecular weight of 751.23 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate.
Molecular Properties
| Compound Name | 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate |
| PubChem CID | 176872446 |
| Molecular Formula | C46H90N2O5 |
| Molecular Weight | 751.23 g/mol |
| Exact Mass | 750.68 |
| IUPAC Name | 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCCCCC)CCCCCCCCC)C(=O)CN |
| InChI | InChI=1S/C46H90N2O5/c1-5-9-13-17-21-25-29-33-42(34-30-26-22-18-14-10-6-2)45(50)52-39-37-48(44(49)41-47)38-40-53-46(51)43(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h42-43H,5-41,47H2,1-4H3 |
| InChIKey | WEMSAKFYDDYHKJ-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 751.23 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate?
The IUPAC name of 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate (CID 176872446) is 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate.
What is the SMILES notation for 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate?
The canonical SMILES for 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate is CCCCCCCCCC(CCCCCCCCC)C(=O)OCCN(CCOC(=O)C(CCCCCCCCC)CCCCCCCCC)C(=O)CN.
What is the InChIKey of 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate?
The InChIKey is WEMSAKFYDDYHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H90N2O5/c1-5-9-13-17-21-25-29-33-42(34-30-26-22-18-14-10-6-2)45(50)52-39-37-48(44(49)41-47)38-40-53-46(51)43(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h42-43H,5-41,47H2,1-4H3.
What are the key properties of 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate?
2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate has a molecular weight of 751.23 g/mol, XLogP of 12.66, 41 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminoacetyl)-[2-(2-nonylundecanoyloxy)ethyl]amino]ethyl 2-nonylundecanoate is sourced from PubChem (CID 176872446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).